C17H27N3O3S — CID 92681982
(3S)-1-(dimethylsulfamoyl)-N-(2-propan-2-ylphenyl)piperidine-3-carboxamide (PubChem CID 92681982) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is (3S)-1-(dimethylsulfamoyl)-N-(2-propan-2-ylphenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(dimethylsulfamoyl)-N-(2-propan-2-ylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92681982 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (3S)-1-(dimethylsulfamoyl)-N-(2-propan-2-ylphenyl)piperidine-3-carboxamide |
| SMILES | CC(C)c1ccccc1NC(=O)[C@H]1CCCN(S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C17H27N3O3S/c1-13(2)15-9-5-6-10-16(15)18-17(21)14-8-7-11-20(12-14)24(22,23)19(3)4/h5-6,9-10,13-14H,7-8,11-12H2,1-4H3,(H,18,21)/t14-/m0/s1 |
| InChIKey | CSJRTQZQBRQOFG-AWEZNQCLSA-N |
| XLogP | 2.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |