C16H25N3O3S2 — CID 93487559
(3S)-1-(dimethylsulfamoyl)-N-(2-ethylsulfanylphenyl)piperidine-3-carboxamide (PubChem CID 93487559) has the molecular formula C16H25N3O3S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is (3S)-1-(dimethylsulfamoyl)-N-(2-ethylsulfanylphenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(dimethylsulfamoyl)-N-(2-ethylsulfanylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93487559 |
| Molecular Formula | C16H25N3O3S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (3S)-1-(dimethylsulfamoyl)-N-(2-ethylsulfanylphenyl)piperidine-3-carboxamide |
| SMILES | CCSc1ccccc1NC(=O)[C@H]1CCCN(S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C16H25N3O3S2/c1-4-23-15-10-6-5-9-14(15)17-16(20)13-8-7-11-19(12-13)24(21,22)18(2)3/h5-6,9-10,13H,4,7-8,11-12H2,1-3H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | WBRBSZFXPHQGFO-ZDUSSCGKSA-N |
| XLogP | 2.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |