C19H30N4O4S — CID 46763501
N-[2-(butan-2-ylcarbamoyl)phenyl]-1-(dimethylsulfamoyl)piperidine-3-carboxamide (PubChem CID 46763501) has the molecular formula C19H30N4O4S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[2-(butan-2-ylcarbamoyl)phenyl]-1-(dimethylsulfamoyl)piperidine-3-carboxamide.
| Compound Name | N-[2-(butan-2-ylcarbamoyl)phenyl]-1-(dimethylsulfamoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46763501 |
| Molecular Formula | C19H30N4O4S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[2-(butan-2-ylcarbamoyl)phenyl]-1-(dimethylsulfamoyl)piperidine-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NC(=O)C1CCCN(S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C19H30N4O4S/c1-5-14(2)20-19(25)16-10-6-7-11-17(16)21-18(24)15-9-8-12-23(13-15)28(26,27)22(3)4/h6-7,10-11,14-15H,5,8-9,12-13H2,1-4H3,(H,20,25)(H,21,24) |
| InChIKey | CIFJZFWQXSSUOX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |