C15H22ClN3O4S — CID 43876123
N-(3-chloro-4-methoxyphenyl)-1-(dimethylsulfamoyl)piperidine-3-carboxamide (PubChem CID 43876123) has the molecular formula C15H22ClN3O4S and a molecular weight of 375.88 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-1-(dimethylsulfamoyl)piperidine-3-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-1-(dimethylsulfamoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43876123 |
| Molecular Formula | C15H22ClN3O4S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-1-(dimethylsulfamoyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCN(S(=O)(=O)N(C)C)C2)cc1Cl |
| InChI | InChI=1S/C15H22ClN3O4S/c1-18(2)24(21,22)19-8-4-5-11(10-19)15(20)17-12-6-7-14(23-3)13(16)9-12/h6-7,9,11H,4-5,8,10H2,1-3H3,(H,17,20) |
| InChIKey | XDXVHJSXJVGZSC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |