C12H16BrN3O3S — CID 77041493
1-(4-bromophenyl)sulfonyl-N'-hydroxypiperidine-3-carboximidamide (PubChem CID 77041493) has the molecular formula C12H16BrN3O3S and a molecular weight of 362.25 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-N'-hydroxypiperidine-3-carboximidamide.
| Compound Name | 1-(4-bromophenyl)sulfonyl-N'-hydroxypiperidine-3-carboximidamide |
|---|---|
| PubChem CID | 77041493 |
| Molecular Formula | C12H16BrN3O3S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-N'-hydroxypiperidine-3-carboximidamide |
| SMILES | NC(=NO)C1CCCN(S(=O)(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C12H16BrN3O3S/c13-10-3-5-11(6-4-10)20(18,19)16-7-1-2-9(8-16)12(14)15-17/h3-6,9,17H,1-2,7-8H2,(H2,14,15) |
| InChIKey | AGFGJNKBZUBRET-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|