C14H18BrNO4S — CID 1345678
ethyl (3R)-1-(4-bromophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 1345678) has the molecular formula C14H18BrNO4S and a molecular weight of 376.27 g/mol. Its IUPAC name is ethyl (3R)-1-(4-bromophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(4-bromophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 1345678 |
| Molecular Formula | C14H18BrNO4S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | ethyl (3R)-1-(4-bromophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(S(=O)(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C14H18BrNO4S/c1-2-20-14(17)11-4-3-9-16(10-11)21(18,19)13-7-5-12(15)6-8-13/h5-8,11H,2-4,9-10H2,1H3/t11-/m1/s1 |
| InChIKey | YVWLNJFPNKNAGN-LLVKDONJSA-N |
| XLogP | 2.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |