C15H20BrNO4S — CID 8777841
ethyl (3R)-1-(5-bromo-2-methylphenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 8777841) has the molecular formula C15H20BrNO4S and a molecular weight of 390.30 g/mol. Its IUPAC name is ethyl (3R)-1-(5-bromo-2-methylphenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(5-bromo-2-methylphenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 8777841 |
| Molecular Formula | C15H20BrNO4S |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | ethyl (3R)-1-(5-bromo-2-methylphenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(S(=O)(=O)c2cc(Br)ccc2C)C1 |
| InChI | InChI=1S/C15H20BrNO4S/c1-3-21-15(18)12-5-4-8-17(10-12)22(19,20)14-9-13(16)7-6-11(14)2/h6-7,9,12H,3-5,8,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | YYPMUDNBJJIVTN-GFCCVEGCSA-N |
| XLogP | 2.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |