C14H17BrClNO4S — CID 42997517
ethyl 1-(4-bromo-2-chlorophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 42997517) has the molecular formula C14H17BrClNO4S and a molecular weight of 410.72 g/mol. Its IUPAC name is ethyl 1-(4-bromo-2-chlorophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl 1-(4-bromo-2-chlorophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 42997517 |
| Molecular Formula | C14H17BrClNO4S |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | ethyl 1-(4-bromo-2-chlorophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(S(=O)(=O)c2ccc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C14H17BrClNO4S/c1-2-21-14(18)10-4-3-7-17(9-10)22(19,20)13-6-5-11(15)8-12(13)16/h5-6,8,10H,2-4,7,9H2,1H3 |
| InChIKey | XYLZNMBLJUDWDM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |