C15H19BrClNO5S — CID 55544338
ethyl 1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 55544338) has the molecular formula C15H19BrClNO5S and a molecular weight of 440.74 g/mol. Its IUPAC name is ethyl 1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl 1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 55544338 |
| Molecular Formula | C15H19BrClNO5S |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | ethyl 1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(S(=O)(=O)c2cc(Cl)cc(Br)c2OC)C1 |
| InChI | InChI=1S/C15H19BrClNO5S/c1-3-23-15(19)10-5-4-6-18(9-10)24(20,21)13-8-11(17)7-12(16)14(13)22-2/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | ABFZLNNFKICTAY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |