C13H18ClNO4S2 — CID 103100561
ethyl 1-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate (PubChem CID 103100561) has the molecular formula C13H18ClNO4S2 and a molecular weight of 351.88 g/mol. Its IUPAC name is ethyl 1-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl 1-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 103100561 |
| Molecular Formula | C13H18ClNO4S2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | ethyl 1-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(S(=O)(=O)c2cc(C)c(Cl)s2)C1 |
| InChI | InChI=1S/C13H18ClNO4S2/c1-3-19-13(16)10-5-4-6-15(8-10)21(17,18)11-7-9(2)12(14)20-11/h7,10H,3-6,8H2,1-2H3 |
| InChIKey | NXGSENULBSLLQQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |