C10H14ClNO3S2 — CID 103100198
[1-(5-chloro-4-methylthiophen-2-yl)sulfonylpyrrolidin-3-yl]methanol (PubChem CID 103100198) has the molecular formula C10H14ClNO3S2 and a molecular weight of 295.81 g/mol. Its IUPAC name is [1-(5-chloro-4-methylthiophen-2-yl)sulfonylpyrrolidin-3-yl]methanol.
| Compound Name | [1-(5-chloro-4-methylthiophen-2-yl)sulfonylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 103100198 |
| Molecular Formula | C10H14ClNO3S2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | [1-(5-chloro-4-methylthiophen-2-yl)sulfonylpyrrolidin-3-yl]methanol |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(CO)C2)sc1Cl |
| InChI | InChI=1S/C10H14ClNO3S2/c1-7-4-9(16-10(7)11)17(14,15)12-3-2-8(5-12)6-13/h4,8,13H,2-3,5-6H2,1H3 |
| InChIKey | DKXNREMHJZWWLY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |