About [1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol
[1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol (PubChem CID 71103813) has the molecular formula C12H15Cl2NO3S
and a molecular weight of 324.23 g/mol. Its IUPAC name is [1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol |
| PubChem CID | 71103813 |
| Molecular Formula | C12H15Cl2NO3S |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | [1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol |
| SMILES | Cc1cc(Cl)c(S(=O)(=O)N2CCC(CO)C2)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO3S/c1-8-4-10(13)12(11(14)5-8)19(17,18)15-3-2-9(6-15)7-16/h4-5,9,16H,2-3,6-7H2,1H3 |
| InChIKey | GSKXMHBZSTWESC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol?
The IUPAC name of [1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol (CID 71103813) is [1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol.
What is the SMILES notation for [1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol?
The canonical SMILES for [1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol is Cc1cc(Cl)c(S(=O)(=O)N2CCC(CO)C2)c(Cl)c1.
What is the InChIKey of [1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol?
The InChIKey is GSKXMHBZSTWESC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2NO3S/c1-8-4-10(13)12(11(14)5-8)19(17,18)15-3-2-9(6-15)7-16/h4-5,9,16H,2-3,6-7H2,1H3.
What are the key properties of [1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol?
[1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol has a molecular weight of 324.23 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,6-dichloro-4-methylphenyl)sulfonylpyrrolidin-3-yl]methanol is sourced from PubChem (CID 71103813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).