C12H14Cl3NO3S — CID 60957920
[1-(2,4,6-trichlorophenyl)sulfonylpiperidin-4-yl]methanol (PubChem CID 60957920) has the molecular formula C12H14Cl3NO3S and a molecular weight of 358.67 g/mol. Its IUPAC name is [1-(2,4,6-trichlorophenyl)sulfonylpiperidin-4-yl]methanol.
| Compound Name | [1-(2,4,6-trichlorophenyl)sulfonylpiperidin-4-yl]methanol |
|---|---|
| PubChem CID | 60957920 |
| Molecular Formula | C12H14Cl3NO3S |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | [1-(2,4,6-trichlorophenyl)sulfonylpiperidin-4-yl]methanol |
| SMILES | O=S(=O)(c1c(Cl)cc(Cl)cc1Cl)N1CCC(CO)CC1 |
| InChI | InChI=1S/C12H14Cl3NO3S/c13-9-5-10(14)12(11(15)6-9)20(18,19)16-3-1-8(7-17)2-4-16/h5-6,8,17H,1-4,7H2 |
| InChIKey | MKBADAVJOPRVGH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |