C12H15Cl2NO3S — CID 66570215
[1-(2,4-dichlorophenyl)sulfonylpiperidin-4-yl]methanol (PubChem CID 66570215) has the molecular formula C12H15Cl2NO3S and a molecular weight of 324.23 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)sulfonylpiperidin-4-yl]methanol.
| Compound Name | [1-(2,4-dichlorophenyl)sulfonylpiperidin-4-yl]methanol |
|---|---|
| PubChem CID | 66570215 |
| Molecular Formula | C12H15Cl2NO3S |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | [1-(2,4-dichlorophenyl)sulfonylpiperidin-4-yl]methanol |
| SMILES | O=S(=O)(c1ccc(Cl)cc1Cl)N1CCC(CO)CC1 |
| InChI | InChI=1S/C12H15Cl2NO3S/c13-10-1-2-12(11(14)7-10)19(17,18)15-5-3-9(8-16)4-6-15/h1-2,7,9,16H,3-6,8H2 |
| InChIKey | PAYSNQOXFWTYSG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |