C20H28Cl2N2O3S — CID 173136420
N-[[1-(2,4-dichlorophenyl)sulfonylpyrrolidin-3-yl]methyl]cyclooctanecarboxamide (PubChem CID 173136420) has the molecular formula C20H28Cl2N2O3S and a molecular weight of 447.43 g/mol. Its IUPAC name is N-[[1-(2,4-dichlorophenyl)sulfonylpyrrolidin-3-yl]methyl]cyclooctanecarboxamide.
| Compound Name | N-[[1-(2,4-dichlorophenyl)sulfonylpyrrolidin-3-yl]methyl]cyclooctanecarboxamide |
|---|---|
| PubChem CID | 173136420 |
| Molecular Formula | C20H28Cl2N2O3S |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-[[1-(2,4-dichlorophenyl)sulfonylpyrrolidin-3-yl]methyl]cyclooctanecarboxamide |
| SMILES | O=C(NCC1CCN(S(=O)(=O)c2ccc(Cl)cc2Cl)C1)C1CCCCCCC1 |
| InChI | InChI=1S/C20H28Cl2N2O3S/c21-17-8-9-19(18(22)12-17)28(26,27)24-11-10-15(14-24)13-23-20(25)16-6-4-2-1-3-5-7-16/h8-9,12,15-16H,1-7,10-11,13-14H2,(H,23,25) |
| InChIKey | POAZCDHHUQUZSI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |