C24H30Cl2N2O3S — CID 70267962
(1R,5R,7R)-N-[[1-(2,4-dichlorophenyl)sulfonylpiperidin-3-yl]methyl]tetracyclo[5.3.1.03,9.05,9]undecane-3-carboxamide (PubChem CID 70267962) has the molecular formula C24H30Cl2N2O3S and a molecular weight of 497.49 g/mol. Its IUPAC name is (1R,5R,7R)-N-[[1-(2,4-dichlorophenyl)sulfonylpiperidin-3-yl]methyl]tetracyclo[5.3.1.03,9.05,9]undecane-3-carboxamide.
| Compound Name | (1R,5R,7R)-N-[[1-(2,4-dichlorophenyl)sulfonylpiperidin-3-yl]methyl]tetracyclo[5.3.1.03,9.05,9]undecane-3-carboxamide |
|---|---|
| PubChem CID | 70267962 |
| Molecular Formula | C24H30Cl2N2O3S |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | (1R,5R,7R)-N-[[1-(2,4-dichlorophenyl)sulfonylpiperidin-3-yl]methyl]tetracyclo[5.3.1.03,9.05,9]undecane-3-carboxamide |
| SMILES | O=C(NCC1CCCN(S(=O)(=O)c2ccc(Cl)cc2Cl)C1)C12C[C@@H]3C[C@@H]4C[C@H](C1)C2(C4)C3 |
| InChI | InChI=1S/C24H30Cl2N2O3S/c25-19-3-4-21(20(26)8-19)32(30,31)28-5-1-2-15(14-28)13-27-22(29)24-11-17-6-16-7-18(12-24)23(24,9-16)10-17/h3-4,8,15-18H,1-2,5-7,9-14H2,(H,27,29)/t15?,16-,17-,18-,23?,24?/m1/s1 |
| InChIKey | KVYKTKCMSZFIDL-TULZXRNESA-N |
| XLogP | 4.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |