C17H23Cl2N3O4S — CID 24961532
2-[1-(2,4-dichlorophenyl)sulfonylpiperidin-3-yl]-N-morpholin-4-ylacetamide (PubChem CID 24961532) has the molecular formula C17H23Cl2N3O4S and a molecular weight of 436.36 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)sulfonylpiperidin-3-yl]-N-morpholin-4-ylacetamide.
| Compound Name | 2-[1-(2,4-dichlorophenyl)sulfonylpiperidin-3-yl]-N-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 24961532 |
| Molecular Formula | C17H23Cl2N3O4S |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)sulfonylpiperidin-3-yl]-N-morpholin-4-ylacetamide |
| SMILES | O=C(CC1CCCN(S(=O)(=O)c2ccc(Cl)cc2Cl)C1)NN1CCOCC1 |
| InChI | InChI=1S/C17H23Cl2N3O4S/c18-14-3-4-16(15(19)11-14)27(24,25)22-5-1-2-13(12-22)10-17(23)20-21-6-8-26-9-7-21/h3-4,11,13H,1-2,5-10,12H2,(H,20,23) |
| InChIKey | KRXXORFCHDRIGR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |