C19H20Cl3N3O3S — CID 24960427
2-[1-(3-chlorophenyl)sulfonylpiperidin-3-yl]-N'-(2,4-dichlorophenyl)acetohydrazide (PubChem CID 24960427) has the molecular formula C19H20Cl3N3O3S and a molecular weight of 476.81 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)sulfonylpiperidin-3-yl]-N'-(2,4-dichlorophenyl)acetohydrazide.
| Compound Name | 2-[1-(3-chlorophenyl)sulfonylpiperidin-3-yl]-N'-(2,4-dichlorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 24960427 |
| Molecular Formula | C19H20Cl3N3O3S |
| Molecular Weight | 476.81 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 2-[1-(3-chlorophenyl)sulfonylpiperidin-3-yl]-N'-(2,4-dichlorophenyl)acetohydrazide |
| SMILES | O=C(CC1CCCN(S(=O)(=O)c2cccc(Cl)c2)C1)NNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl3N3O3S/c20-14-4-1-5-16(10-14)29(27,28)25-8-2-3-13(12-25)9-19(26)24-23-18-7-6-15(21)11-17(18)22/h1,4-7,10-11,13,23H,2-3,8-9,12H2,(H,24,26) |
| InChIKey | HZJJTFFWXKOWCA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.81 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|