C18H17Cl3N2O3S — CID 43042431
1-(4-chlorophenyl)sulfonyl-N-(2,4-dichlorophenyl)piperidine-3-carboxamide (PubChem CID 43042431) has the molecular formula C18H17Cl3N2O3S and a molecular weight of 447.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-(2,4-dichlorophenyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-(2,4-dichlorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43042431 |
| Molecular Formula | C18H17Cl3N2O3S |
| Molecular Weight | 447.77 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-(2,4-dichlorophenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)C1CCCN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H17Cl3N2O3S/c19-13-3-6-15(7-4-13)27(25,26)23-9-1-2-12(11-23)18(24)22-17-8-5-14(20)10-16(17)21/h3-8,10,12H,1-2,9,11H2,(H,22,24) |
| InChIKey | JUTHQSMKTKMYRN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.77 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |