C18H16BrCl3N2O3S — CID 126391105
(3R)-1-(4-bromophenyl)sulfonyl-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide (PubChem CID 126391105) has the molecular formula C18H16BrCl3N2O3S and a molecular weight of 526.67 g/mol. Its IUPAC name is (3R)-1-(4-bromophenyl)sulfonyl-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(4-bromophenyl)sulfonyl-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 126391105 |
| Molecular Formula | C18H16BrCl3N2O3S |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 523.91 |
| IUPAC Name | (3R)-1-(4-bromophenyl)sulfonyl-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)[C@@H]1CCCN(S(=O)(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C18H16BrCl3N2O3S/c19-12-3-5-13(6-4-12)28(26,27)24-7-1-2-11(10-24)18(25)23-17-9-15(21)14(20)8-16(17)22/h3-6,8-9,11H,1-2,7,10H2,(H,23,25)/t11-/m1/s1 |
| InChIKey | MOTMHIXAWSDNAX-LLVKDONJSA-N |
| XLogP | 5.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|