C14H18Cl3N3O3S — CID 43905928
1-(dimethylsulfamoyl)-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide (PubChem CID 43905928) has the molecular formula C14H18Cl3N3O3S and a molecular weight of 414.74 g/mol. Its IUPAC name is 1-(dimethylsulfamoyl)-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide.
| Compound Name | 1-(dimethylsulfamoyl)-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43905928 |
| Molecular Formula | C14H18Cl3N3O3S |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | 1-(dimethylsulfamoyl)-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)N1CCCC(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H18Cl3N3O3S/c1-19(2)24(22,23)20-5-3-4-9(8-20)14(21)18-13-7-11(16)10(15)6-12(13)17/h6-7,9H,3-5,8H2,1-2H3,(H,18,21) |
| InChIKey | WNXSDMQJWWXYQB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|