C9H19N3O3S — CID 94012254
(3R)-1-(dimethylsulfamoyl)-N-methylpiperidine-3-carboxamide (PubChem CID 94012254) has the molecular formula C9H19N3O3S and a molecular weight of 249.34 g/mol. Its IUPAC name is (3R)-1-(dimethylsulfamoyl)-N-methylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-(dimethylsulfamoyl)-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94012254 |
| Molecular Formula | C9H19N3O3S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (3R)-1-(dimethylsulfamoyl)-N-methylpiperidine-3-carboxamide |
| SMILES | CNC(=O)[C@@H]1CCCN(S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C9H19N3O3S/c1-10-9(13)8-5-4-6-12(7-8)16(14,15)11(2)3/h8H,4-7H2,1-3H3,(H,10,13)/t8-/m1/s1 |
| InChIKey | WBVBTFANQIMEQN-MRVPVSSYSA-N |
| XLogP | -0.75 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |