C12H25N3O3S — CID 92685694
(3S)-1-(dimethylsulfamoyl)-N,N-diethylpiperidine-3-carboxamide (PubChem CID 92685694) has the molecular formula C12H25N3O3S and a molecular weight of 291.42 g/mol. Its IUPAC name is (3S)-1-(dimethylsulfamoyl)-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-(dimethylsulfamoyl)-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92685694 |
| Molecular Formula | C12H25N3O3S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (3S)-1-(dimethylsulfamoyl)-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1CCCN(S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C12H25N3O3S/c1-5-14(6-2)12(16)11-8-7-9-15(10-11)19(17,18)13(3)4/h11H,5-10H2,1-4H3/t11-/m0/s1 |
| InChIKey | CONQTGWZMFNOQU-NSHDSACASA-N |
| XLogP | 0.37 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |