C18H28N2O3S — CID 100780184
(3S)-1-(2,5-dimethylphenyl)sulfonyl-N,N-diethylpiperidine-3-carboxamide (PubChem CID 100780184) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is (3S)-1-(2,5-dimethylphenyl)sulfonyl-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-(2,5-dimethylphenyl)sulfonyl-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 100780184 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (3S)-1-(2,5-dimethylphenyl)sulfonyl-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1CCCN(S(=O)(=O)c2cc(C)ccc2C)C1 |
| InChI | InChI=1S/C18H28N2O3S/c1-5-19(6-2)18(21)16-8-7-11-20(13-16)24(22,23)17-12-14(3)9-10-15(17)4/h9-10,12,16H,5-8,11,13H2,1-4H3/t16-/m0/s1 |
| InChIKey | BEMZWPYCNLXUCG-INIZCTEOSA-N |
| XLogP | 2.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |