C28H32N2O3S — CID 100780190
(3R)-N,N-dibenzyl-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 100780190) has the molecular formula C28H32N2O3S and a molecular weight of 476.64 g/mol. Its IUPAC name is (3R)-N,N-dibenzyl-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N,N-dibenzyl-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 100780190 |
| Molecular Formula | C28H32N2O3S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | (3R)-N,N-dibenzyl-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC[C@@H](C(=O)N(Cc3ccccc3)Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C28H32N2O3S/c1-22-15-16-23(2)27(18-22)34(32,33)30-17-9-14-26(21-30)28(31)29(19-24-10-5-3-6-11-24)20-25-12-7-4-8-13-25/h3-8,10-13,15-16,18,26H,9,14,17,19-21H2,1-2H3/t26-/m1/s1 |
| InChIKey | JGVARMQQRTVKLH-AREMUKBSSA-N |
| XLogP | 4.93 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |