C28H32N2O4S — CID 41301972
(3S)-N,N-dibenzyl-1-(4-methoxy-3-methylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 41301972) has the molecular formula C28H32N2O4S and a molecular weight of 492.64 g/mol. Its IUPAC name is (3S)-N,N-dibenzyl-1-(4-methoxy-3-methylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N,N-dibenzyl-1-(4-methoxy-3-methylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 41301972 |
| Molecular Formula | C28H32N2O4S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | (3S)-N,N-dibenzyl-1-(4-methoxy-3-methylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)N(Cc3ccccc3)Cc3ccccc3)C2)cc1C |
| InChI | InChI=1S/C28H32N2O4S/c1-22-18-26(15-16-27(22)34-2)35(32,33)30-17-9-14-25(21-30)28(31)29(19-23-10-5-3-6-11-23)20-24-12-7-4-8-13-24/h3-8,10-13,15-16,18,25H,9,14,17,19-21H2,1-2H3/t25-/m0/s1 |
| InChIKey | BPIUARVXOUWLMG-VWLOTQADSA-N |
| XLogP | 4.63 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |