C27H30N2O3S — CID 100780299
(3R)-N-benzhydryl-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 100780299) has the molecular formula C27H30N2O3S and a molecular weight of 462.62 g/mol. Its IUPAC name is (3R)-N-benzhydryl-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-benzhydryl-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 100780299 |
| Molecular Formula | C27H30N2O3S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | (3R)-N-benzhydryl-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC[C@@H](C(=O)NC(c3ccccc3)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C27H30N2O3S/c1-20-15-16-21(2)25(18-20)33(31,32)29-17-9-14-24(19-29)27(30)28-26(22-10-5-3-6-11-22)23-12-7-4-8-13-23/h3-8,10-13,15-16,18,24,26H,9,14,17,19H2,1-2H3,(H,28,30)/t24-/m1/s1 |
| InChIKey | ZIKKULLTNSNIKM-XMMPIXPASA-N |
| XLogP | 4.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |