C22H28N2O3S — CID 133254929
1-(2,5-dimethylphenyl)sulfonyl-N-(1-phenylethyl)piperidine-3-carboxamide (PubChem CID 133254929) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonyl-N-(1-phenylethyl)piperidine-3-carboxamide.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonyl-N-(1-phenylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133254929 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonyl-N-(1-phenylethyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCCC(C(=O)NC(C)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C22H28N2O3S/c1-16-11-12-17(2)21(14-16)28(26,27)24-13-7-10-20(15-24)22(25)23-18(3)19-8-5-4-6-9-19/h4-6,8-9,11-12,14,18,20H,7,10,13,15H2,1-3H3,(H,23,25) |
| InChIKey | RWAGAZNJXBRREJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |