C25H26N2O3S — CID 46438239
1-(benzenesulfonyl)-N-benzhydrylpiperidine-3-carboxamide (PubChem CID 46438239) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-benzhydrylpiperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-benzhydrylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46438239 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1-(benzenesulfonyl)-N-benzhydrylpiperidine-3-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)C1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C25H26N2O3S/c28-25(26-24(20-11-4-1-5-12-20)21-13-6-2-7-14-21)22-15-10-18-27(19-22)31(29,30)23-16-8-3-9-17-23/h1-9,11-14,16-17,22,24H,10,15,18-19H2,(H,26,28) |
| InChIKey | URUOHPWQWUIRRE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |