C27H30N2O5S — CID 55414462
N-[(4-methoxyphenyl)-phenylmethyl]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 55414462) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)-phenylmethyl]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)-phenylmethyl]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55414462 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-[(4-methoxyphenyl)-phenylmethyl]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | COc1ccc(C(NC(=O)C2CCCN(S(=O)(=O)c3ccc(OC)cc3)C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H30N2O5S/c1-33-23-12-10-21(11-13-23)26(20-7-4-3-5-8-20)28-27(30)22-9-6-18-29(19-22)35(31,32)25-16-14-24(34-2)15-17-25/h3-5,7-8,10-17,22,26H,6,9,18-19H2,1-2H3,(H,28,30) |
| InChIKey | SXXOFNSPVGFJCL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |