C23H30N2O3S — CID 5110733
N-benzyl-N-methyl-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 5110733) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is N-benzyl-N-methyl-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-benzyl-N-methyl-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 5110733 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N-benzyl-N-methyl-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCCC(C(=O)N(C)Cc3ccccc3)C2)c(C)c1 |
| InChI | InChI=1S/C23H30N2O3S/c1-17-13-18(2)22(19(3)14-17)29(27,28)25-12-8-11-21(16-25)23(26)24(4)15-20-9-6-5-7-10-20/h5-7,9-10,13-14,21H,8,11-12,15-16H2,1-4H3 |
| InChIKey | PAYRTOVLOMJAPI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |