C20H22Cl2N2O3S — CID 126397995
(3S)-N-benzyl-1-(2,5-dichlorophenyl)sulfonyl-N-methylpiperidine-3-carboxamide (PubChem CID 126397995) has the molecular formula C20H22Cl2N2O3S and a molecular weight of 441.38 g/mol. Its IUPAC name is (3S)-N-benzyl-1-(2,5-dichlorophenyl)sulfonyl-N-methylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-benzyl-1-(2,5-dichlorophenyl)sulfonyl-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 126397995 |
| Molecular Formula | C20H22Cl2N2O3S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | (3S)-N-benzyl-1-(2,5-dichlorophenyl)sulfonyl-N-methylpiperidine-3-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)[C@H]1CCCN(S(=O)(=O)c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C20H22Cl2N2O3S/c1-23(13-15-6-3-2-4-7-15)20(25)16-8-5-11-24(14-16)28(26,27)19-12-17(21)9-10-18(19)22/h2-4,6-7,9-10,12,16H,5,8,11,13-14H2,1H3/t16-/m0/s1 |
| InChIKey | WSMWLQYLINZZSB-INIZCTEOSA-N |
| XLogP | 4.05 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |