C16H22Cl2N2O3S — CID 126396308
(3R)-N-tert-butyl-1-(2,5-dichlorophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 126396308) has the molecular formula C16H22Cl2N2O3S and a molecular weight of 393.34 g/mol. Its IUPAC name is (3R)-N-tert-butyl-1-(2,5-dichlorophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-tert-butyl-1-(2,5-dichlorophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 126396308 |
| Molecular Formula | C16H22Cl2N2O3S |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (3R)-N-tert-butyl-1-(2,5-dichlorophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1CCCN(S(=O)(=O)c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C16H22Cl2N2O3S/c1-16(2,3)19-15(21)11-5-4-8-20(10-11)24(22,23)14-9-12(17)6-7-13(14)18/h6-7,9,11H,4-5,8,10H2,1-3H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | OOYQADACYPMNOJ-LLVKDONJSA-N |
| XLogP | 3.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |