C20H21Cl2N3O4S — CID 126398447
(3S)-N-(4-acetamidophenyl)-1-(2,5-dichlorophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 126398447) has the molecular formula C20H21Cl2N3O4S and a molecular weight of 470.38 g/mol. Its IUPAC name is (3S)-N-(4-acetamidophenyl)-1-(2,5-dichlorophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-(4-acetamidophenyl)-1-(2,5-dichlorophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 126398447 |
| Molecular Formula | C20H21Cl2N3O4S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | (3S)-N-(4-acetamidophenyl)-1-(2,5-dichlorophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@H]2CCCN(S(=O)(=O)c3cc(Cl)ccc3Cl)C2)cc1 |
| InChI | InChI=1S/C20H21Cl2N3O4S/c1-13(26)23-16-5-7-17(8-6-16)24-20(27)14-3-2-10-25(12-14)30(28,29)19-11-15(21)4-9-18(19)22/h4-9,11,14H,2-3,10,12H2,1H3,(H,23,26)(H,24,27)/t14-/m0/s1 |
| InChIKey | ZAUUELOIPYCXEP-AWEZNQCLSA-N |
| XLogP | 3.99 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |