C18H17Cl2FN2O3S — CID 2992639
1-(2,5-dichlorophenyl)sulfonyl-N-(2-fluorophenyl)piperidine-3-carboxamide (PubChem CID 2992639) has the molecular formula C18H17Cl2FN2O3S and a molecular weight of 431.32 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-N-(2-fluorophenyl)piperidine-3-carboxamide.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-N-(2-fluorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 2992639 |
| Molecular Formula | C18H17Cl2FN2O3S |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-N-(2-fluorophenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1F)C1CCCN(S(=O)(=O)c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C18H17Cl2FN2O3S/c19-13-7-8-14(20)17(10-13)27(25,26)23-9-3-4-12(11-23)18(24)22-16-6-2-1-5-15(16)21/h1-2,5-8,10,12H,3-4,9,11H2,(H,22,24) |
| InChIKey | ANGXUHUCBPZCHE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |