C18H15Cl2F3N2O3S — CID 26358144
1-(2,5-dichlorophenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-4-carboxamide (PubChem CID 26358144) has the molecular formula C18H15Cl2F3N2O3S and a molecular weight of 467.30 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26358144 |
| Molecular Formula | C18H15Cl2F3N2O3S |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H15Cl2F3N2O3S/c19-11-1-2-12(20)15(9-11)29(27,28)25-7-5-10(6-8-25)18(26)24-14-4-3-13(21)16(22)17(14)23/h1-4,9-10H,5-8H2,(H,24,26) |
| InChIKey | RANLEFPQQOESJU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|