C16H15F3N2O3S2 — CID 9095289
1-thiophen-2-ylsulfonyl-N-(2,3,4-trifluorophenyl)piperidine-4-carboxamide (PubChem CID 9095289) has the molecular formula C16H15F3N2O3S2 and a molecular weight of 404.44 g/mol. Its IUPAC name is 1-thiophen-2-ylsulfonyl-N-(2,3,4-trifluorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-thiophen-2-ylsulfonyl-N-(2,3,4-trifluorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9095289 |
| Molecular Formula | C16H15F3N2O3S2 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 1-thiophen-2-ylsulfonyl-N-(2,3,4-trifluorophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C16H15F3N2O3S2/c17-11-3-4-12(15(19)14(11)18)20-16(22)10-5-7-21(8-6-10)26(23,24)13-2-1-9-25-13/h1-4,9-10H,5-8H2,(H,20,22) |
| InChIKey | IQGCNLJYDCZFRO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|