C21H27N3O5S3 — CID 55920459
N-(2-piperidin-1-ylsulfonylphenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 55920459) has the molecular formula C21H27N3O5S3 and a molecular weight of 497.66 g/mol. Its IUPAC name is N-(2-piperidin-1-ylsulfonylphenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-piperidin-1-ylsulfonylphenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55920459 |
| Molecular Formula | C21H27N3O5S3 |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | N-(2-piperidin-1-ylsulfonylphenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1S(=O)(=O)N1CCCCC1)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C21H27N3O5S3/c25-21(17-10-14-24(15-11-17)32(28,29)20-9-6-16-30-20)22-18-7-2-3-8-19(18)31(26,27)23-12-4-1-5-13-23/h2-3,6-9,16-17H,1,4-5,10-15H2,(H,22,25) |
| InChIKey | FAYSHEIRRHBHLR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |