C18H22N2O5S2 — CID 7960898
N-(3,5-dimethoxyphenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 7960898) has the molecular formula C18H22N2O5S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 7960898 |
| Molecular Formula | C18H22N2O5S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | COc1cc(NC(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C18H22N2O5S2/c1-24-15-10-14(11-16(12-15)25-2)19-18(21)13-5-7-20(8-6-13)27(22,23)17-4-3-9-26-17/h3-4,9-13H,5-8H2,1-2H3,(H,19,21) |
| InChIKey | KJDCLAFAPNXASK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |