C19H21ClN2O5S2 — CID 28575511
ethyl 2-chloro-4-[(1-thiophen-2-ylsulfonylpiperidine-4-carbonyl)amino]benzoate (PubChem CID 28575511) has the molecular formula C19H21ClN2O5S2 and a molecular weight of 456.97 g/mol. Its IUPAC name is ethyl 2-chloro-4-[(1-thiophen-2-ylsulfonylpiperidine-4-carbonyl)amino]benzoate.
| Compound Name | ethyl 2-chloro-4-[(1-thiophen-2-ylsulfonylpiperidine-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 28575511 |
| Molecular Formula | C19H21ClN2O5S2 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | ethyl 2-chloro-4-[(1-thiophen-2-ylsulfonylpiperidine-4-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)cc1Cl |
| InChI | InChI=1S/C19H21ClN2O5S2/c1-2-27-19(24)15-6-5-14(12-16(15)20)21-18(23)13-7-9-22(10-8-13)29(25,26)17-4-3-11-28-17/h3-6,11-13H,2,7-10H2,1H3,(H,21,23) |
| InChIKey | NFXIWRADBKJETN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |