C23H23ClN2O5S3 — CID 4089309
ethyl 4-(4-chlorophenyl)-2-[(1-thiophen-2-ylsulfonylpiperidine-4-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 4089309) has the molecular formula C23H23ClN2O5S3 and a molecular weight of 539.10 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-2-[(1-thiophen-2-ylsulfonylpiperidine-4-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-2-[(1-thiophen-2-ylsulfonylpiperidine-4-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4089309 |
| Molecular Formula | C23H23ClN2O5S3 |
| Molecular Weight | 539.10 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-2-[(1-thiophen-2-ylsulfonylpiperidine-4-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C23H23ClN2O5S3/c1-2-31-23(28)20-18(15-5-7-17(24)8-6-15)14-33-22(20)25-21(27)16-9-11-26(12-10-16)34(29,30)19-4-3-13-32-19/h3-8,13-14,16H,2,9-12H2,1H3,(H,25,27) |
| InChIKey | AVSJJMUKSYUFNT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.10 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|