C25H24ClN3O6S3 — CID 3316379
ethyl 4-(4-chlorophenyl)-2-[(4-morpholin-4-ylsulfonylbenzoyl)carbamothioylamino]thiophene-3-carboxylate (PubChem CID 3316379) has the molecular formula C25H24ClN3O6S3 and a molecular weight of 594.14 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-2-[(4-morpholin-4-ylsulfonylbenzoyl)carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-2-[(4-morpholin-4-ylsulfonylbenzoyl)carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3316379 |
| Molecular Formula | C25H24ClN3O6S3 |
| Molecular Weight | 594.14 g/mol |
| Exact Mass | 593.05 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-2-[(4-morpholin-4-ylsulfonylbenzoyl)carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=S)NC(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H24ClN3O6S3/c1-2-35-24(31)21-20(16-3-7-18(26)8-4-16)15-37-23(21)28-25(36)27-22(30)17-5-9-19(10-6-17)38(32,33)29-11-13-34-14-12-29/h3-10,15H,2,11-14H2,1H3,(H2,27,28,30,36) |
| InChIKey | WLBNMGYPNSQGLR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.14 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|