C17H19N3O6S2 — CID 55333508
ethyl 2-[(4-morpholin-4-ylsulfonylbenzoyl)amino]-1,3-thiazole-4-carboxylate (PubChem CID 55333508) has the molecular formula C17H19N3O6S2 and a molecular weight of 425.49 g/mol. Its IUPAC name is ethyl 2-[(4-morpholin-4-ylsulfonylbenzoyl)amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(4-morpholin-4-ylsulfonylbenzoyl)amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 55333508 |
| Molecular Formula | C17H19N3O6S2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | ethyl 2-[(4-morpholin-4-ylsulfonylbenzoyl)amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NC(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C17H19N3O6S2/c1-2-26-16(22)14-11-27-17(18-14)19-15(21)12-3-5-13(6-4-12)28(23,24)20-7-9-25-10-8-20/h3-6,11H,2,7-10H2,1H3,(H,18,19,21) |
| InChIKey | RFPVJPJYEDYMBD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |