C14H11N3O3S — CID 748001
ethyl 2-[(4-cyanobenzoyl)amino]-1,3-thiazole-4-carboxylate (PubChem CID 748001) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is ethyl 2-[(4-cyanobenzoyl)amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(4-cyanobenzoyl)amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 748001 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | ethyl 2-[(4-cyanobenzoyl)amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NC(=O)c2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C14H11N3O3S/c1-2-20-13(19)11-8-21-14(16-11)17-12(18)10-5-3-9(7-15)4-6-10/h3-6,8H,2H2,1H3,(H,16,17,18) |
| InChIKey | VQXSMRKXWBVDRV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |