C14H13N3O3S — CID 104850151
ethyl 2-(4-cyano-2-methoxyanilino)-1,3-thiazole-4-carboxylate (PubChem CID 104850151) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is ethyl 2-(4-cyano-2-methoxyanilino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(4-cyano-2-methoxyanilino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 104850151 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | ethyl 2-(4-cyano-2-methoxyanilino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(Nc2ccc(C#N)cc2OC)n1 |
| InChI | InChI=1S/C14H13N3O3S/c1-3-20-13(18)11-8-21-14(17-11)16-10-5-4-9(7-15)6-12(10)19-2/h4-6,8H,3H2,1-2H3,(H,16,17) |
| InChIKey | HKAGWDWHFGXUIR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |