C13H13BrN2O3S — CID 82861980
ethyl 2-(4-bromo-3-methoxyanilino)-1,3-thiazole-4-carboxylate (PubChem CID 82861980) has the molecular formula C13H13BrN2O3S and a molecular weight of 357.23 g/mol. Its IUPAC name is ethyl 2-(4-bromo-3-methoxyanilino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(4-bromo-3-methoxyanilino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 82861980 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | ethyl 2-(4-bromo-3-methoxyanilino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(Nc2ccc(Br)c(OC)c2)n1 |
| InChI | InChI=1S/C13H13BrN2O3S/c1-3-19-12(17)10-7-20-13(16-10)15-8-4-5-9(14)11(6-8)18-2/h4-7H,3H2,1-2H3,(H,15,16) |
| InChIKey | VBDAPDUZZMAJRC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |