C13H12Br2N2O2S — CID 80567895
ethyl 2-(2,6-dibromo-4-methylanilino)-1,3-thiazole-4-carboxylate (PubChem CID 80567895) has the molecular formula C13H12Br2N2O2S and a molecular weight of 420.13 g/mol. Its IUPAC name is ethyl 2-(2,6-dibromo-4-methylanilino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(2,6-dibromo-4-methylanilino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 80567895 |
| Molecular Formula | C13H12Br2N2O2S |
| Molecular Weight | 420.13 g/mol |
| Exact Mass | 417.90 |
| IUPAC Name | ethyl 2-(2,6-dibromo-4-methylanilino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(Nc2c(Br)cc(C)cc2Br)n1 |
| InChI | InChI=1S/C13H12Br2N2O2S/c1-3-19-12(18)10-6-20-13(16-10)17-11-8(14)4-7(2)5-9(11)15/h4-6H,3H2,1-2H3,(H,16,17) |
| InChIKey | UIUWUMFVZKDBRI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.13 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |