C14H10N4O2S — CID 107794704
ethyl 2-(3,4-dicyanoanilino)-1,3-thiazole-4-carboxylate (PubChem CID 107794704) has the molecular formula C14H10N4O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is ethyl 2-(3,4-dicyanoanilino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(3,4-dicyanoanilino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 107794704 |
| Molecular Formula | C14H10N4O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | ethyl 2-(3,4-dicyanoanilino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(Nc2ccc(C#N)c(C#N)c2)n1 |
| InChI | InChI=1S/C14H10N4O2S/c1-2-20-13(19)12-8-21-14(18-12)17-11-4-3-9(6-15)10(5-11)7-16/h3-5,8H,2H2,1H3,(H,17,18) |
| InChIKey | NDJNEHDDOSGHGK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 98.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |