C12H10F2N2O2S — CID 112724637
ethyl 2-(2,4-difluoroanilino)-1,3-thiazole-4-carboxylate (PubChem CID 112724637) has the molecular formula C12H10F2N2O2S and a molecular weight of 284.29 g/mol. Its IUPAC name is ethyl 2-(2,4-difluoroanilino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(2,4-difluoroanilino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 112724637 |
| Molecular Formula | C12H10F2N2O2S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | ethyl 2-(2,4-difluoroanilino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C12H10F2N2O2S/c1-2-18-11(17)10-6-19-12(16-10)15-9-4-3-7(13)5-8(9)14/h3-6H,2H2,1H3,(H,15,16) |
| InChIKey | ABMPXTOTTVDJOK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |