C13H12F2N2OS — CID 123550387
3-[2-(2,4-difluoroanilino)-1,3-thiazol-4-yl]but-3-en-2-ol (PubChem CID 123550387) has the molecular formula C13H12F2N2OS and a molecular weight of 282.31 g/mol. Its IUPAC name is 3-[2-(2,4-difluoroanilino)-1,3-thiazol-4-yl]but-3-en-2-ol.
| Compound Name | 3-[2-(2,4-difluoroanilino)-1,3-thiazol-4-yl]but-3-en-2-ol |
|---|---|
| PubChem CID | 123550387 |
| Molecular Formula | C13H12F2N2OS |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-[2-(2,4-difluoroanilino)-1,3-thiazol-4-yl]but-3-en-2-ol |
| SMILES | C=C(c1csc(Nc2ccc(F)cc2F)n1)C(C)O |
| InChI | InChI=1S/C13H12F2N2OS/c1-7(8(2)18)12-6-19-13(17-12)16-11-4-3-9(14)5-10(11)15/h3-6,8,18H,1H2,2H3,(H,16,17) |
| InChIKey | CZTHAPYUPRWMIV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |